C14H24N8O6 — CID 90390462
2,6-bis(3-azidopropoxycarbonylamino)hexanoic acid (PubChem CID 90390462) has the molecular formula C14H24N8O6 and a molecular weight of 400.40 g/mol. Its IUPAC name is 2,6-bis(3-azidopropoxycarbonylamino)hexanoic acid.
| Compound Name | 2,6-bis(3-azidopropoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 90390462 |
| Molecular Formula | C14H24N8O6 |
| Molecular Weight | 400.40 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 2,6-bis(3-azidopropoxycarbonylamino)hexanoic acid |
| SMILES | [N-]=[N+]=NCCCOC(=O)NCCCCC(NC(=O)OCCCN=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C14H24N8O6/c15-21-18-7-3-9-27-13(25)17-6-2-1-5-11(12(23)24)20-14(26)28-10-4-8-19-22-16/h11H,1-10H2,(H,17,25)(H,20,26)(H,23,24) |
| InChIKey | ORVZSOODZOKDEZ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 211.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|