C10H17N7O3 — CID 164574979
(2R)-6-azido-2-(4-azidobutanoylamino)hexanoic acid (PubChem CID 164574979) has the molecular formula C10H17N7O3 and a molecular weight of 283.29 g/mol. Its IUPAC name is (2R)-6-azido-2-(4-azidobutanoylamino)hexanoic acid.
| Compound Name | (2R)-6-azido-2-(4-azidobutanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 164574979 |
| Molecular Formula | C10H17N7O3 |
| Molecular Weight | 283.29 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (2R)-6-azido-2-(4-azidobutanoylamino)hexanoic acid |
| SMILES | [N-]=[N+]=NCCCC[C@@H](NC(=O)CCCN=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C10H17N7O3/c11-16-13-6-2-1-4-8(10(19)20)15-9(18)5-3-7-14-17-12/h8H,1-7H2,(H,15,18)(H,19,20)/t8-/m1/s1 |
| InChIKey | MZDRAARJOSWGML-MRVPVSSYSA-N |
| XLogP | 2.13 |
| TPSA | 163.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.29 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|