C12H19N5O6 — CID 122616995
2-[2-(4-azidobutanoylamino)propanoylamino]pentanedioic acid (PubChem CID 122616995) has the molecular formula C12H19N5O6 and a molecular weight of 329.31 g/mol. Its IUPAC name is 2-[2-(4-azidobutanoylamino)propanoylamino]pentanedioic acid.
| Compound Name | 2-[2-(4-azidobutanoylamino)propanoylamino]pentanedioic acid |
|---|---|
| PubChem CID | 122616995 |
| Molecular Formula | C12H19N5O6 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | 2-[2-(4-azidobutanoylamino)propanoylamino]pentanedioic acid |
| SMILES | CC(NC(=O)CCCN=[N+]=[N-])C(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H19N5O6/c1-7(15-9(18)3-2-6-14-17-13)11(21)16-8(12(22)23)4-5-10(19)20/h7-8H,2-6H2,1H3,(H,15,18)(H,16,21)(H,19,20)(H,22,23) |
| InChIKey | DWJUTZKQIXRFKJ-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 181.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|