C15H24N6O8 — CID 154608077
(2S)-5-amino-2-[[(1S)-4-[[(1S)-4-azido-1-carboxybutyl]amino]-1-carboxy-4-oxobutyl]amino]-5-oxopentanoic acid (PubChem CID 154608077) has the molecular formula C15H24N6O8 and a molecular weight of 416.39 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(1S)-4-[[(1S)-4-azido-1-carboxybutyl]amino]-1-carboxy-4-oxobutyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(1S)-4-[[(1S)-4-azido-1-carboxybutyl]amino]-1-carboxy-4-oxobutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 154608077 |
| Molecular Formula | C15H24N6O8 |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | (2S)-5-amino-2-[[(1S)-4-[[(1S)-4-azido-1-carboxybutyl]amino]-1-carboxy-4-oxobutyl]amino]-5-oxopentanoic acid |
| SMILES | [N-]=[N+]=NCCC[C@H](NC(=O)CC[C@H](N[C@@H](CCC(N)=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24N6O8/c16-11(22)5-3-9(14(26)27)19-10(15(28)29)4-6-12(23)20-8(13(24)25)2-1-7-18-21-17/h8-10,19H,1-7H2,(H2,16,22)(H,20,23)(H,24,25)(H,26,27)(H,28,29)/t8-,9-,10-/m0/s1 |
| InChIKey | WIWPKJCAAODDMF-GUBZILKMSA-N |
| XLogP | -0.81 |
| TPSA | 244.88 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|