C9H15N5O4S2 — CID 159199182
3-[(2-amino-2-oxoethyl)disulfanyl]-2-(4-azidobutanoylamino)propanoic acid (PubChem CID 159199182) has the molecular formula C9H15N5O4S2 and a molecular weight of 321.38 g/mol. Its IUPAC name is 3-[(2-amino-2-oxoethyl)disulfanyl]-2-(4-azidobutanoylamino)propanoic acid.
| Compound Name | 3-[(2-amino-2-oxoethyl)disulfanyl]-2-(4-azidobutanoylamino)propanoic acid |
|---|---|
| PubChem CID | 159199182 |
| Molecular Formula | C9H15N5O4S2 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 3-[(2-amino-2-oxoethyl)disulfanyl]-2-(4-azidobutanoylamino)propanoic acid |
| SMILES | [N-]=[N+]=NCCCC(=O)NC(CSSCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H15N5O4S2/c10-7(15)5-20-19-4-6(9(17)18)13-8(16)2-1-3-12-14-11/h6H,1-5H2,(H2,10,15)(H,13,16)(H,17,18) |
| InChIKey | JABQJTBDXDASRS-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 158.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|