C11H19N3O7S2 — CID 14253338
(2S)-2-amino-5-[[(1R)-2-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-1-carboxyethyl]amino]-5-oxopentanoic acid (PubChem CID 14253338) has the molecular formula C11H19N3O7S2 and a molecular weight of 369.42 g/mol. Its IUPAC name is (2S)-2-amino-5-[[(1R)-2-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-1-carboxyethyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-5-[[(1R)-2-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-1-carboxyethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 14253338 |
| Molecular Formula | C11H19N3O7S2 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | (2S)-2-amino-5-[[(1R)-2-[[(2R)-2-amino-2-carboxyethyl]disulfanyl]-1-carboxyethyl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CSSC[C@H](N)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H19N3O7S2/c12-5(9(16)17)1-2-8(15)14-7(11(20)21)4-23-22-3-6(13)10(18)19/h5-7H,1-4,12-13H2,(H,14,15)(H,16,17)(H,18,19)(H,20,21)/t5-,6-,7-/m0/s1 |
| InChIKey | BURBYWNSQNXLSI-ACZMJKKPSA-N |
| XLogP | -1.46 |
| TPSA | 193.04 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|