C11H18N2O5S — CID 70151345
2-amino-5-[[(1R)-1-carboxy-2-[(Z)-prop-1-enyl]sulfanylethyl]amino]-5-oxopentanoic acid (PubChem CID 70151345) has the molecular formula C11H18N2O5S and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-amino-5-[[(1R)-1-carboxy-2-[(Z)-prop-1-enyl]sulfanylethyl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[[(1R)-1-carboxy-2-[(Z)-prop-1-enyl]sulfanylethyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 70151345 |
| Molecular Formula | C11H18N2O5S |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-amino-5-[[(1R)-1-carboxy-2-[(Z)-prop-1-enyl]sulfanylethyl]amino]-5-oxopentanoic acid |
| SMILES | C/C=C\SC[C@H](NC(=O)CCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C11H18N2O5S/c1-2-5-19-6-8(11(17)18)13-9(14)4-3-7(12)10(15)16/h2,5,7-8H,3-4,6,12H2,1H3,(H,13,14)(H,15,16)(H,17,18)/b5-2-/t7?,8-/m0/s1 |
| InChIKey | MUFSTXJBHAEIBT-TZSKAKPUSA-N |
| XLogP | 0.01 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |