C16H28N4O10S2 — CID 174544229
2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid (PubChem CID 174544229) has the molecular formula C16H28N4O10S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is 2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174544229 |
| Molecular Formula | C16H28N4O10S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | 2-amino-5-[(1-carboxy-2-sulfanylethyl)amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CS)C(=O)O)C(=O)O.NC(CCC(=O)NC(CS)C(=O)O)C(=O)O |
| InChI | InChI=1S/2C8H14N2O5S/c2*9-4(7(12)13)1-2-6(11)10-5(3-16)8(14)15/h2*4-5,16H,1-3,9H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | ROXGNMSHZJSEQI-UHFFFAOYSA-N |
| XLogP | -2.64 |
| TPSA | 259.44 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -2.64 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|