C10H17AsN3O6S — CID 157487593
CID 157487593 (PubChem CID 157487593) has the molecular formula C10H17AsN3O6S and a molecular weight of 382.25 g/mol.
| Compound Name | CID 157487593 |
|---|---|
| PubChem CID | 157487593 |
| Molecular Formula | C10H17AsN3O6S |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.01 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O.[As] |
| InChI | InChI=1S/C10H17N3O6S.As/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);/t5-,6-;/m0./s1 |
| InChIKey | BWWXJFBYZZJEEN-GEMLJDPKSA-N |
| XLogP | -2.59 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | -2.59 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|