C16H29N5O10S3 — CID 174868868
2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 174868868) has the molecular formula C16H29N5O10S3 and a molecular weight of 547.63 g/mol. Its IUPAC name is 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 174868868 |
| Molecular Formula | C16H29N5O10S3 |
| Molecular Weight | 547.63 g/mol |
| Exact Mass | 547.11 |
| IUPAC Name | 2-amino-3-[(2-amino-2-carboxyethyl)disulfanyl]propanoic acid;2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O.NC(CSSCC(N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S.C6H12N2O4S2/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;7-3(5(9)10)1-13-14-2-4(8)6(11)12/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);3-4H,1-2,7-8H2,(H,9,10)(H,11,12) |
| InChIKey | IQTRCZCDRMZWCK-UHFFFAOYSA-N |
| XLogP | -3.01 |
| TPSA | 285.46 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.63 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|