C20H34N6O12S2Se — CID 158170006
CID 158170006 (PubChem CID 158170006) has the molecular formula C20H34N6O12S2Se and a molecular weight of 693.62 g/mol.
| Compound Name | CID 158170006 |
|---|---|
| PubChem CID | 158170006 |
| Molecular Formula | C20H34N6O12S2Se |
| Molecular Weight | 693.62 g/mol |
| Exact Mass | 694.08 |
| IUPAC Name | — |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O.N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O.[Se] |
| InChI | InChI=1S/2C10H17N3O6S.Se/c2*11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;/h2*5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);/t2*5-,6-;/m00./s1 |
| InChIKey | FXIJXJFYAWKLMQ-PRKWKTPOSA-N |
| XLogP | -4.79 |
| TPSA | 317.64 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.62 |
| LogP ≤ 5 | -4.79 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|