C12H23N3O6S — CID 145181639
2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;ethane (PubChem CID 145181639) has the molecular formula C12H23N3O6S and a molecular weight of 337.40 g/mol. Its IUPAC name is 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;ethane.
| Compound Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 145181639 |
| Molecular Formula | C12H23N3O6S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 2-amino-5-[[1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid;ethane |
| SMILES | CC.NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S.C2H6/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;1-2/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);1-2H3 |
| InChIKey | QBWNKYCSFZHAQM-UHFFFAOYSA-N |
| XLogP | -1.18 |
| TPSA | 158.82 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|