C10H19N3O12S3 — CID 174613055
CID 174613055 (PubChem CID 174613055) has the molecular formula C10H19N3O12S3 and a molecular weight of 469.47 g/mol.
| Compound Name | CID 174613055 |
|---|---|
| PubChem CID | 174613055 |
| Molecular Formula | C10H19N3O12S3 |
| Molecular Weight | 469.47 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | — |
| SMILES | NC(CCC(=O)NC(CS)C(=O)NCC(=O)O)C(=O)O.O=S(=O)(O)S(=O)(=O)O |
| InChI | InChI=1S/C10H17N3O6S.H2O6S2/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;1-7(2,3)8(4,5)6/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);(H,1,2,3)(H,4,5,6) |
| InChIKey | YXBJQAWNYJZBPF-UHFFFAOYSA-N |
| XLogP | -3.53 |
| TPSA | 267.56 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.47 |
| LogP ≤ 5 | -3.53 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|