C18H33N5O10S3 — CID 159261464
(2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid;(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid (PubChem CID 159261464) has the molecular formula C18H33N5O10S3 and a molecular weight of 575.69 g/mol. Its IUPAC name is (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid;(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid;(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 159261464 |
| Molecular Formula | C18H33N5O10S3 |
| Molecular Weight | 575.69 g/mol |
| Exact Mass | 575.14 |
| IUPAC Name | (2S)-2-amino-4-[[(3S)-3-amino-3-carboxypropyl]disulfanyl]butanoic acid;(2S)-2-amino-5-[[(2R)-1-(carboxymethylamino)-1-oxo-3-sulfanylpropan-2-yl]amino]-5-oxopentanoic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](CS)C(=O)NCC(=O)O)C(=O)O.N[C@@H](CCSSCC[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H17N3O6S.C8H16N2O4S2/c11-5(10(18)19)1-2-7(14)13-6(4-20)9(17)12-3-8(15)16;9-5(7(11)12)1-3-15-16-4-2-6(10)8(13)14/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19);5-6H,1-4,9-10H2,(H,11,12)(H,13,14)/t2*5-,6-/m00/s1 |
| InChIKey | KWOIEVQPRWJXBF-CKCBUVOCSA-N |
| XLogP | -2.23 |
| TPSA | 285.46 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.69 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|