C10H16N2O7 — CID 87289628
(2S)-2-[(4-amino-4-carboxybutanoyl)amino]pentanedioic acid (PubChem CID 87289628) has the molecular formula C10H16N2O7 and a molecular weight of 276.24 g/mol. Its IUPAC name is (2S)-2-[(4-amino-4-carboxybutanoyl)amino]pentanedioic acid.
| Compound Name | (2S)-2-[(4-amino-4-carboxybutanoyl)amino]pentanedioic acid |
|---|---|
| PubChem CID | 87289628 |
| Molecular Formula | C10H16N2O7 |
| Molecular Weight | 276.24 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (2S)-2-[(4-amino-4-carboxybutanoyl)amino]pentanedioic acid |
| SMILES | NC(CCC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C10H16N2O7/c11-5(9(16)17)1-3-7(13)12-6(10(18)19)2-4-8(14)15/h5-6H,1-4,11H2,(H,12,13)(H,14,15)(H,16,17)(H,18,19)/t5?,6-/m0/s1 |
| InChIKey | OWQDWQKWSLFFFR-GDVGLLTNSA-N |
| XLogP | -1.39 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.24 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |