C9H14N2O7 — CID 87795061
(2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanedioic acid (PubChem CID 87795061) has the molecular formula C9H14N2O7 and a molecular weight of 262.22 g/mol. Its IUPAC name is (2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 87795061 |
| Molecular Formula | C9H14N2O7 |
| Molecular Weight | 262.22 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | (2S)-2-[[(3S)-3-amino-3-carboxypropanoyl]amino]pentanedioic acid |
| SMILES | N[C@@H](CC(=O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H14N2O7/c10-4(8(15)16)3-6(12)11-5(9(17)18)1-2-7(13)14/h4-5H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)(H,17,18)/t4-,5-/m0/s1 |
| InChIKey | DBMVITQDGVMXEY-WHFBIAKZSA-N |
| XLogP | -1.78 |
| TPSA | 167.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.22 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |