C14H24N3O12P — CID 138719861
(2S)-2-[[[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-carboxypropoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 138719861) has the molecular formula C14H24N3O12P and a molecular weight of 457.33 g/mol. Its IUPAC name is (2S)-2-[[[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-carboxypropoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-carboxypropoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 138719861 |
| Molecular Formula | C14H24N3O12P |
| Molecular Weight | 457.33 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (2S)-2-[[[3-[[(4S)-4-amino-4-carboxybutanoyl]amino]-3-carboxypropoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | N[C@@H](CCC(=O)NC(CCOP(=O)(O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H24N3O12P/c15-7(12(21)22)1-3-10(18)16-8(13(23)24)5-6-29-30(27,28)17-9(14(25)26)2-4-11(19)20/h7-9H,1-6,15H2,(H,16,18)(H,19,20)(H,21,22)(H,23,24)(H,25,26)(H2,17,27,28)/t7-,8?,9-/m0/s1 |
| InChIKey | DAOFTWXSVRXDOF-SMOXQLQSSA-N |
| XLogP | -1.84 |
| TPSA | 262.88 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.33 |
| LogP ≤ 5 | -1.84 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|