C17H28N3O13P — CID 168792982
2-[[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 168792982) has the molecular formula C17H28N3O13P and a molecular weight of 513.39 g/mol. Its IUPAC name is 2-[[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 168792982 |
| Molecular Formula | C17H28N3O13P |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 513.14 |
| IUPAC Name | 2-[[[4-[(4-acetamido-4-carboxybutanoyl)amino]-4-carboxybutoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | CC(=O)NC(CCC(=O)NC(CCCOP(=O)(O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C17H28N3O13P/c1-9(21)18-11(16(27)28)4-6-13(22)19-10(15(25)26)3-2-8-33-34(31,32)20-12(17(29)30)5-7-14(23)24/h10-12H,2-8H2,1H3,(H,18,21)(H,19,22)(H,23,24)(H,25,26)(H,27,28)(H,29,30)(H2,20,31,32) |
| InChIKey | WSDIEERSQQCWAU-UHFFFAOYSA-N |
| XLogP | -1.27 |
| TPSA | 265.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|