C23H41N4O12P — CID 163775891
(2S)-2-(6-acetamidohexanoylamino)-5-[[(1S)-1-carboxy-4-[(1-carboxybutylamino)-hydroxyphosphoryl]oxybutyl]amino]-5-oxopentanoic acid (PubChem CID 163775891) has the molecular formula C23H41N4O12P and a molecular weight of 596.57 g/mol. Its IUPAC name is (2S)-2-(6-acetamidohexanoylamino)-5-[[(1S)-1-carboxy-4-[(1-carboxybutylamino)-hydroxyphosphoryl]oxybutyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-(6-acetamidohexanoylamino)-5-[[(1S)-1-carboxy-4-[(1-carboxybutylamino)-hydroxyphosphoryl]oxybutyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 163775891 |
| Molecular Formula | C23H41N4O12P |
| Molecular Weight | 596.57 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (2S)-2-(6-acetamidohexanoylamino)-5-[[(1S)-1-carboxy-4-[(1-carboxybutylamino)-hydroxyphosphoryl]oxybutyl]amino]-5-oxopentanoic acid |
| SMILES | CCCC(NP(=O)(O)OCCC[C@H](NC(=O)CC[C@H](NC(=O)CCCCCNC(C)=O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C23H41N4O12P/c1-3-8-18(23(35)36)27-40(37,38)39-14-7-9-16(21(31)32)25-20(30)12-11-17(22(33)34)26-19(29)10-5-4-6-13-24-15(2)28/h16-18H,3-14H2,1-2H3,(H,24,28)(H,25,30)(H,26,29)(H,31,32)(H,33,34)(H,35,36)(H2,27,37,38)/t16-,17-,18?/m0/s1 |
| InChIKey | PKUKDHMYDRETIB-UBFHEZILSA-N |
| XLogP | 0.34 |
| TPSA | 257.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.57 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|