C27H50N5O12P — CID 138719824
(2S)-2-[[[(4R)-4-[[(4S)-4-[6-(6-aminohexanoylamino)hexanoylamino]-4-carboxybutanoyl]amino]pentoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 138719824) has the molecular formula C27H50N5O12P and a molecular weight of 667.69 g/mol. Its IUPAC name is (2S)-2-[[[(4R)-4-[[(4S)-4-[6-(6-aminohexanoylamino)hexanoylamino]-4-carboxybutanoyl]amino]pentoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(4R)-4-[[(4S)-4-[6-(6-aminohexanoylamino)hexanoylamino]-4-carboxybutanoyl]amino]pentoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 138719824 |
| Molecular Formula | C27H50N5O12P |
| Molecular Weight | 667.69 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | (2S)-2-[[[(4R)-4-[[(4S)-4-[6-(6-aminohexanoylamino)hexanoylamino]-4-carboxybutanoyl]amino]pentoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | C[C@H](CCCOP(=O)(O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)CC[C@H](NC(=O)CCCCCNC(=O)CCCCCN)C(=O)O |
| InChI | InChI=1S/C27H50N5O12P/c1-19(9-8-18-44-45(42,43)32-21(27(40)41)13-15-25(36)37)30-24(35)14-12-20(26(38)39)31-23(34)11-5-3-7-17-29-22(33)10-4-2-6-16-28/h19-21H,2-18,28H2,1H3,(H,29,33)(H,30,35)(H,31,34)(H,36,37)(H,38,39)(H,40,41)(H2,32,42,43)/t19-,20+,21+/m1/s1 |
| InChIKey | MQYYDCICEMDYBF-HKBOAZHASA-N |
| XLogP | 0.84 |
| TPSA | 283.78 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.69 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|