C13H26N2O5 — CID 142985665
2-(6-aminohexanoylamino)pentanedioic acid;ethane (PubChem CID 142985665) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is 2-(6-aminohexanoylamino)pentanedioic acid;ethane.
| Compound Name | 2-(6-aminohexanoylamino)pentanedioic acid;ethane |
|---|---|
| PubChem CID | 142985665 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | 2-(6-aminohexanoylamino)pentanedioic acid;ethane |
| SMILES | CC.NCCCCCC(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C11H20N2O5.C2H6/c12-7-3-1-2-4-9(14)13-8(11(17)18)5-6-10(15)16;1-2/h8H,1-7,12H2,(H,13,14)(H,15,16)(H,17,18);1-2H3 |
| InChIKey | GDVSJCSRRKZFOY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|