C14H29N3O3 — CID 118249963
(2S)-6-amino-2-(8-aminooctanoylamino)hexanoic acid (PubChem CID 118249963) has the molecular formula C14H29N3O3 and a molecular weight of 287.40 g/mol. Its IUPAC name is (2S)-6-amino-2-(8-aminooctanoylamino)hexanoic acid.
| Compound Name | (2S)-6-amino-2-(8-aminooctanoylamino)hexanoic acid |
|---|---|
| PubChem CID | 118249963 |
| Molecular Formula | C14H29N3O3 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.22 |
| IUPAC Name | (2S)-6-amino-2-(8-aminooctanoylamino)hexanoic acid |
| SMILES | NCCCCCCCC(=O)N[C@@H](CCCCN)C(=O)O |
| InChI | InChI=1S/C14H29N3O3/c15-10-6-3-1-2-4-9-13(18)17-12(14(19)20)8-5-7-11-16/h12H,1-11,15-16H2,(H,17,18)(H,19,20)/t12-/m0/s1 |
| InChIKey | WHUPWWPTYRCJLR-LBPRGKRZSA-N |
| XLogP | 0.98 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|