C18H31N2O12P — CID 138475725
2-[[[(4S)-4-carboxy-4-[[(4R)-4-carboxy-5-methylhexanoyl]amino]butoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 138475725) has the molecular formula C18H31N2O12P and a molecular weight of 498.42 g/mol. Its IUPAC name is 2-[[[(4S)-4-carboxy-4-[[(4R)-4-carboxy-5-methylhexanoyl]amino]butoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | 2-[[[(4S)-4-carboxy-4-[[(4R)-4-carboxy-5-methylhexanoyl]amino]butoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 138475725 |
| Molecular Formula | C18H31N2O12P |
| Molecular Weight | 498.42 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | 2-[[[(4S)-4-carboxy-4-[[(4R)-4-carboxy-5-methylhexanoyl]amino]butoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | CC(C)[C@@H](CCC(=O)N[C@@H](CCCOP(=O)(O)NC(CCC(=O)O)C(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C18H31N2O12P/c1-10(2)11(16(24)25)5-7-14(21)19-12(17(26)27)4-3-9-32-33(30,31)20-13(18(28)29)6-8-15(22)23/h10-13H,3-9H2,1-2H3,(H,19,21)(H,22,23)(H,24,25)(H,26,27)(H,28,29)(H2,20,30,31)/t11-,12+,13?/m1/s1 |
| InChIKey | INHDDIMBYLETMS-OJRHAOMCSA-N |
| XLogP | 0.50 |
| TPSA | 236.86 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|