C13H24N3O12P — CID 88954827
(2S)-2-[[[(2S)-2-[[(4R)-4-amino-4-(hydroxymethoxy)butanoyl]amino]-2-carboxyethoxy]-hydroxyphosphoryl]amino]pentanedioic acid (PubChem CID 88954827) has the molecular formula C13H24N3O12P and a molecular weight of 445.32 g/mol. Its IUPAC name is (2S)-2-[[[(2S)-2-[[(4R)-4-amino-4-(hydroxymethoxy)butanoyl]amino]-2-carboxyethoxy]-hydroxyphosphoryl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[[(2S)-2-[[(4R)-4-amino-4-(hydroxymethoxy)butanoyl]amino]-2-carboxyethoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 88954827 |
| Molecular Formula | C13H24N3O12P |
| Molecular Weight | 445.32 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | (2S)-2-[[[(2S)-2-[[(4R)-4-amino-4-(hydroxymethoxy)butanoyl]amino]-2-carboxyethoxy]-hydroxyphosphoryl]amino]pentanedioic acid |
| SMILES | N[C@@H](CCC(=O)N[C@@H](COP(=O)(O)N[C@@H](CCC(=O)O)C(=O)O)C(=O)O)OCO |
| InChI | InChI=1S/C13H24N3O12P/c14-9(27-6-17)2-3-10(18)15-8(13(23)24)5-28-29(25,26)16-7(12(21)22)1-4-11(19)20/h7-9,17H,1-6,14H2,(H,15,18)(H,19,20)(H,21,22)(H,23,24)(H2,16,25,26)/t7-,8-,9+/m0/s1 |
| InChIKey | XWEXTCPQWLWTIA-XHNCKOQMSA-N |
| XLogP | -2.39 |
| TPSA | 255.04 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.32 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|