C14H25N2O11P — CID 140629415
2-[[[(2S)-2-[3-(2-aminoethoxy)propanoylamino]-2-carboxyethoxy]-hydroxyphosphoryl]methyl]pentanedioic acid (PubChem CID 140629415) has the molecular formula C14H25N2O11P and a molecular weight of 428.33 g/mol. Its IUPAC name is 2-[[[(2S)-2-[3-(2-aminoethoxy)propanoylamino]-2-carboxyethoxy]-hydroxyphosphoryl]methyl]pentanedioic acid.
| Compound Name | 2-[[[(2S)-2-[3-(2-aminoethoxy)propanoylamino]-2-carboxyethoxy]-hydroxyphosphoryl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 140629415 |
| Molecular Formula | C14H25N2O11P |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | 2-[[[(2S)-2-[3-(2-aminoethoxy)propanoylamino]-2-carboxyethoxy]-hydroxyphosphoryl]methyl]pentanedioic acid |
| SMILES | NCCOCCC(=O)N[C@@H](COP(=O)(O)CC(CCC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C14H25N2O11P/c15-4-6-26-5-3-11(17)16-10(14(22)23)7-27-28(24,25)8-9(13(20)21)1-2-12(18)19/h9-10H,1-8,15H2,(H,16,17)(H,18,19)(H,20,21)(H,22,23)(H,24,25)/t9?,10-/m0/s1 |
| InChIKey | LIYZOSKJFAABMP-AXDSSHIGSA-N |
| XLogP | -1.31 |
| TPSA | 222.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|