C34H67O19P — CID 134564914
2-[bis[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phosphorylmethyl]pentanedioic acid (PubChem CID 134564914) has the molecular formula C34H67O19P and a molecular weight of 810.86 g/mol. Its IUPAC name is 2-[bis[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phosphorylmethyl]pentanedioic acid.
| Compound Name | 2-[bis[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phosphorylmethyl]pentanedioic acid |
|---|---|
| PubChem CID | 134564914 |
| Molecular Formula | C34H67O19P |
| Molecular Weight | 810.86 g/mol |
| Exact Mass | 810.40 |
| IUPAC Name | 2-[bis[2-[2-[2-[2-[2-(2-ethoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]phosphorylmethyl]pentanedioic acid |
| SMILES | CCOCCOCCOCCOCCOCCOCCOP(=O)(CC(CCC(=O)O)C(=O)O)OCCOCCOCCOCCOCCOCCOCC |
| InChI | InChI=1S/C34H67O19P/c1-3-40-7-9-42-11-13-44-15-17-46-19-21-48-23-25-50-27-29-52-54(39,31-32(34(37)38)5-6-33(35)36)53-30-28-51-26-24-49-22-20-47-18-16-45-14-12-43-10-8-41-4-2/h32H,3-31H2,1-2H3,(H,35,36)(H,37,38) |
| InChIKey | TZRWVDKPZQNOHF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 220.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 46 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.86 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|