C16H31O9P — CID 140903597
2-[bis(3-ethoxypropoxy)phosphorylmethyl]pentanedioic acid (PubChem CID 140903597) has the molecular formula C16H31O9P and a molecular weight of 398.39 g/mol. Its IUPAC name is 2-[bis(3-ethoxypropoxy)phosphorylmethyl]pentanedioic acid.
| Compound Name | 2-[bis(3-ethoxypropoxy)phosphorylmethyl]pentanedioic acid |
|---|---|
| PubChem CID | 140903597 |
| Molecular Formula | C16H31O9P |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-[bis(3-ethoxypropoxy)phosphorylmethyl]pentanedioic acid |
| SMILES | CCOCCCOP(=O)(CC(CCC(=O)O)C(=O)O)OCCCOCC |
| InChI | InChI=1S/C16H31O9P/c1-3-22-9-5-11-24-26(21,25-12-6-10-23-4-2)13-14(16(19)20)7-8-15(17)18/h14H,3-13H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | KGDHRZBPOWFWIA-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|