C13H23O7P — CID 118895962
4-(diethoxyphosphorylmethyl)-5-oxo-5-prop-2-enoxypentanoic acid (PubChem CID 118895962) has the molecular formula C13H23O7P and a molecular weight of 322.29 g/mol. Its IUPAC name is 4-(diethoxyphosphorylmethyl)-5-oxo-5-prop-2-enoxypentanoic acid.
| Compound Name | 4-(diethoxyphosphorylmethyl)-5-oxo-5-prop-2-enoxypentanoic acid |
|---|---|
| PubChem CID | 118895962 |
| Molecular Formula | C13H23O7P |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 4-(diethoxyphosphorylmethyl)-5-oxo-5-prop-2-enoxypentanoic acid |
| SMILES | C=CCOC(=O)C(CCC(=O)O)CP(=O)(OCC)OCC |
| InChI | InChI=1S/C13H23O7P/c1-4-9-18-13(16)11(7-8-12(14)15)10-21(17,19-5-2)20-6-3/h4,11H,1,5-10H2,2-3H3,(H,14,15) |
| InChIKey | MQUATJSTFIDMNW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|