C13H25O6P — CID 159621156
4-[[ethoxy(methyl)phosphoryl]methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid (PubChem CID 159621156) has the molecular formula C13H25O6P and a molecular weight of 308.31 g/mol. Its IUPAC name is 4-[[ethoxy(methyl)phosphoryl]methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid.
| Compound Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 159621156 |
| Molecular Formula | C13H25O6P |
| Molecular Weight | 308.31 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 4-[[ethoxy(methyl)phosphoryl]methyl]-5-[(2-methylpropan-2-yl)oxy]-5-oxopentanoic acid |
| SMILES | CCOP(C)(=O)CC(CCC(=O)O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H25O6P/c1-6-18-20(5,17)9-10(7-8-11(14)15)12(16)19-13(2,3)4/h10H,6-9H2,1-5H3,(H,14,15) |
| InChIKey | VSDXIBFUVWNPMB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|