C10H19O7P — CID 118871925
2-(diethoxyphosphorylmethyl)pentanedioic acid (PubChem CID 118871925) has the molecular formula C10H19O7P and a molecular weight of 282.23 g/mol. Its IUPAC name is 2-(diethoxyphosphorylmethyl)pentanedioic acid.
| Compound Name | 2-(diethoxyphosphorylmethyl)pentanedioic acid |
|---|---|
| PubChem CID | 118871925 |
| Molecular Formula | C10H19O7P |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 2-(diethoxyphosphorylmethyl)pentanedioic acid |
| SMILES | CCOP(=O)(CC(CCC(=O)O)C(=O)O)OCC |
| InChI | InChI=1S/C10H19O7P/c1-3-16-18(15,17-4-2)7-8(10(13)14)5-6-9(11)12/h8H,3-7H2,1-2H3,(H,11,12)(H,13,14) |
| InChIKey | XKBRGCWFAUOUSR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|