C10H21N2O6P — CID 46931731
(4S)-5-amino-4-(diethoxyphosphorylmethylamino)-5-oxopentanoic acid (PubChem CID 46931731) has the molecular formula C10H21N2O6P and a molecular weight of 296.26 g/mol. Its IUPAC name is (4S)-5-amino-4-(diethoxyphosphorylmethylamino)-5-oxopentanoic acid.
| Compound Name | (4S)-5-amino-4-(diethoxyphosphorylmethylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 46931731 |
| Molecular Formula | C10H21N2O6P |
| Molecular Weight | 296.26 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (4S)-5-amino-4-(diethoxyphosphorylmethylamino)-5-oxopentanoic acid |
| SMILES | CCOP(=O)(CN[C@@H](CCC(=O)O)C(N)=O)OCC |
| InChI | InChI=1S/C10H21N2O6P/c1-3-17-19(16,18-4-2)7-12-8(10(11)15)5-6-9(13)14/h8,12H,3-7H2,1-2H3,(H2,11,15)(H,13,14)/t8-/m0/s1 |
| InChIKey | NFGNJNYHHHVIIV-QMMMGPOBSA-N |
| XLogP | 0.52 |
| TPSA | 127.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.26 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|