C11H25N2O6P — CID 87478703
(2S,5R)-6-amino-2-(diethoxyphosphorylmethylamino)-5-hydroxyhexanoic acid (PubChem CID 87478703) has the molecular formula C11H25N2O6P and a molecular weight of 312.30 g/mol. Its IUPAC name is (2S,5R)-6-amino-2-(diethoxyphosphorylmethylamino)-5-hydroxyhexanoic acid.
| Compound Name | (2S,5R)-6-amino-2-(diethoxyphosphorylmethylamino)-5-hydroxyhexanoic acid |
|---|---|
| PubChem CID | 87478703 |
| Molecular Formula | C11H25N2O6P |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | (2S,5R)-6-amino-2-(diethoxyphosphorylmethylamino)-5-hydroxyhexanoic acid |
| SMILES | CCOP(=O)(CN[C@@H](CC[C@@H](O)CN)C(=O)O)OCC |
| InChI | InChI=1S/C11H25N2O6P/c1-3-18-20(17,19-4-2)8-13-10(11(15)16)6-5-9(14)7-12/h9-10,13-14H,3-8,12H2,1-2H3,(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | HXXIDBLNBQFGAJ-ZJUUUORDSA-N |
| XLogP | 0.35 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|