C13H26NO7PS — CID 87883199
2-(butoxycarbonylamino)-3-(diethoxyphosphorylmethylsulfanyl)propanoic acid (PubChem CID 87883199) has the molecular formula C13H26NO7PS and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-3-(diethoxyphosphorylmethylsulfanyl)propanoic acid.
| Compound Name | 2-(butoxycarbonylamino)-3-(diethoxyphosphorylmethylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 87883199 |
| Molecular Formula | C13H26NO7PS |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 2-(butoxycarbonylamino)-3-(diethoxyphosphorylmethylsulfanyl)propanoic acid |
| SMILES | CCCCOC(=O)NC(CSCP(=O)(OCC)OCC)C(=O)O |
| InChI | InChI=1S/C13H26NO7PS/c1-4-7-8-19-13(17)14-11(12(15)16)9-23-10-22(18,20-5-2)21-6-3/h11H,4-10H2,1-3H3,(H,14,17)(H,15,16) |
| InChIKey | FPUUKHXJQHCVLH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|