C10H19NO4S — CID 54317613
(2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoic acid (PubChem CID 54317613) has the molecular formula C10H19NO4S and a molecular weight of 249.33 g/mol. Its IUPAC name is (2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 54317613 |
| Molecular Formula | C10H19NO4S |
| Molecular Weight | 249.33 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | (2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoic acid |
| SMILES | CCCCOC(=O)N[C@@H](CCSC)C(=O)O |
| InChI | InChI=1S/C10H19NO4S/c1-3-4-6-15-10(14)11-8(9(12)13)5-7-16-2/h8H,3-7H2,1-2H3,(H,11,14)(H,12,13)/t8-/m0/s1 |
| InChIKey | SPISXULQEPGYHT-QMMMGPOBSA-N |
| XLogP | 1.72 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|