C13H23NO4S — CID 6420956
butyl 4-methylsulfanyl-2-(prop-2-enoxycarbonylamino)butanoate (PubChem CID 6420956) has the molecular formula C13H23NO4S and a molecular weight of 289.40 g/mol. Its IUPAC name is butyl 4-methylsulfanyl-2-(prop-2-enoxycarbonylamino)butanoate.
| Compound Name | butyl 4-methylsulfanyl-2-(prop-2-enoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 6420956 |
| Molecular Formula | C13H23NO4S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | butyl 4-methylsulfanyl-2-(prop-2-enoxycarbonylamino)butanoate |
| SMILES | C=CCOC(=O)NC(CCSC)C(=O)OCCCC |
| InChI | InChI=1S/C13H23NO4S/c1-4-6-9-17-12(15)11(7-10-19-3)14-13(16)18-8-5-2/h5,11H,2,4,6-10H2,1,3H3,(H,14,16) |
| InChIKey | ABBKVKLXQXUSKP-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|