C23H36N2O5S — CID 146175373
benzyl (2S)-2-[[(2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate (PubChem CID 146175373) has the molecular formula C23H36N2O5S and a molecular weight of 452.62 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 146175373 |
| Molecular Formula | C23H36N2O5S |
| Molecular Weight | 452.62 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | benzyl (2S)-2-[[(2S)-2-(butoxycarbonylamino)-4-methylsulfanylbutanoyl]amino]-4-methylpentanoate |
| SMILES | CCCCOC(=O)N[C@@H](CCSC)C(=O)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H36N2O5S/c1-5-6-13-29-23(28)25-19(12-14-31-4)21(26)24-20(15-17(2)3)22(27)30-16-18-10-8-7-9-11-18/h7-11,17,19-20H,5-6,12-16H2,1-4H3,(H,24,26)(H,25,28)/t19-,20-/m0/s1 |
| InChIKey | WNBWRSXOMHPATO-PMACEKPBSA-N |
| XLogP | 3.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.62 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|