C24H38N2O5 — CID 69347942
benzyl (2S)-2-[[(2R)-2-(butoxycarbonylamino)-4-methylpentanoyl]amino]-4-methylpentanoate (PubChem CID 69347942) has the molecular formula C24H38N2O5 and a molecular weight of 434.58 g/mol. Its IUPAC name is benzyl (2S)-2-[[(2R)-2-(butoxycarbonylamino)-4-methylpentanoyl]amino]-4-methylpentanoate.
| Compound Name | benzyl (2S)-2-[[(2R)-2-(butoxycarbonylamino)-4-methylpentanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 69347942 |
| Molecular Formula | C24H38N2O5 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.28 |
| IUPAC Name | benzyl (2S)-2-[[(2R)-2-(butoxycarbonylamino)-4-methylpentanoyl]amino]-4-methylpentanoate |
| SMILES | CCCCOC(=O)N[C@H](CC(C)C)C(=O)N[C@@H](CC(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H38N2O5/c1-6-7-13-30-24(29)26-20(14-17(2)3)22(27)25-21(15-18(4)5)23(28)31-16-19-11-9-8-10-12-19/h8-12,17-18,20-21H,6-7,13-16H2,1-5H3,(H,25,27)(H,26,29)/t20-,21+/m1/s1 |
| InChIKey | NFNFOMWMLORBON-RTWAWAEBSA-N |
| XLogP | 4.20 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|