C19H30N2O3 — CID 70548380
butyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 70548380) has the molecular formula C19H30N2O3 and a molecular weight of 334.46 g/mol. Its IUPAC name is butyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | butyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 70548380 |
| Molecular Formula | C19H30N2O3 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.23 |
| IUPAC Name | butyl (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CCCCOC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C19H30N2O3/c1-4-5-11-24-19(23)17(12-14(2)3)21-18(22)16(20)13-15-9-7-6-8-10-15/h6-10,14,16-17H,4-5,11-13,20H2,1-3H3,(H,21,22)/t16-,17-/m0/s1 |
| InChIKey | OSFXXOWZOMGGHV-IRXDYDNUSA-N |
| XLogP | 2.43 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|