C17H21F3N2O4 — CID 175150702
(2,2,2-trifluoroacetyl) (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 175150702) has the molecular formula C17H21F3N2O4 and a molecular weight of 374.36 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 175150702 |
| Molecular Formula | C17H21F3N2O4 |
| Molecular Weight | 374.36 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CC(C)C[C@@H](NC(=O)[C@H](N)Cc1ccccc1)C(=O)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H21F3N2O4/c1-10(2)8-13(15(24)26-16(25)17(18,19)20)22-14(23)12(21)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,21H2,1-2H3,(H,22,23)/t12-,13-/m1/s1 |
| InChIKey | GSANEAMFCDTQGD-CHWSQXEVSA-N |
| XLogP | 1.72 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.36 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|