C23H30N2O3 — CID 89128188
(2,4-dimethylphenyl) (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 89128188) has the molecular formula C23H30N2O3 and a molecular weight of 382.50 g/mol. Its IUPAC name is (2,4-dimethylphenyl) (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | (2,4-dimethylphenyl) (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 89128188 |
| Molecular Formula | C23H30N2O3 |
| Molecular Weight | 382.50 g/mol |
| Exact Mass | 382.23 |
| IUPAC Name | (2,4-dimethylphenyl) (2S)-2-[[(2S)-2-amino-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | Cc1ccc(OC(=O)[C@H](CC(C)C)NC(=O)[C@@H](N)Cc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C23H30N2O3/c1-15(2)12-20(23(27)28-21-11-10-16(3)13-17(21)4)25-22(26)19(24)14-18-8-6-5-7-9-18/h5-11,13,15,19-20H,12,14,24H2,1-4H3,(H,25,26)/t19-,20-/m0/s1 |
| InChIKey | LAPZGMBSSYPDPX-PMACEKPBSA-N |
| XLogP | 3.31 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.50 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|