C17H32N2O4S — CID 559811
butyl 2-[(2-acetamido-4-methylpentanoyl)amino]-4-methylsulfanylbutanoate (PubChem CID 559811) has the molecular formula C17H32N2O4S and a molecular weight of 360.52 g/mol. Its IUPAC name is butyl 2-[(2-acetamido-4-methylpentanoyl)amino]-4-methylsulfanylbutanoate.
| Compound Name | butyl 2-[(2-acetamido-4-methylpentanoyl)amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 559811 |
| Molecular Formula | C17H32N2O4S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | butyl 2-[(2-acetamido-4-methylpentanoyl)amino]-4-methylsulfanylbutanoate |
| SMILES | CCCCOC(=O)C(CCSC)NC(=O)C(CC(C)C)NC(C)=O |
| InChI | InChI=1S/C17H32N2O4S/c1-6-7-9-23-17(22)14(8-10-24-5)19-16(21)15(11-12(2)3)18-13(4)20/h12,14-15H,6-11H2,1-5H3,(H,18,20)(H,19,21) |
| InChIKey | LOSFLQSMRJSHNF-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|