C20H35N3O5S — CID 134824608
(2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-[[(3S)-5-methylsulfanyl-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]pentanamide (PubChem CID 134824608) has the molecular formula C20H35N3O5S and a molecular weight of 429.58 g/mol. Its IUPAC name is (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-[[(3S)-5-methylsulfanyl-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]pentanamide.
| Compound Name | (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-[[(3S)-5-methylsulfanyl-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]pentanamide |
|---|---|
| PubChem CID | 134824608 |
| Molecular Formula | C20H35N3O5S |
| Molecular Weight | 429.58 g/mol |
| Exact Mass | 429.23 |
| IUPAC Name | (2S)-2-acetamido-4-methyl-N-[(2S)-4-methyl-1-[[(3S)-5-methylsulfanyl-1,2-dioxopentan-3-yl]amino]-1-oxopentan-2-yl]pentanamide |
| SMILES | CSCC[C@H](NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CC(C)C)NC(C)=O)C(=O)C=O |
| InChI | InChI=1S/C20H35N3O5S/c1-12(2)9-16(21-14(5)25)19(27)23-17(10-13(3)4)20(28)22-15(7-8-29-6)18(26)11-24/h11-13,15-17H,7-10H2,1-6H3,(H,21,25)(H,22,28)(H,23,27)/t15-,16-,17-/m0/s1 |
| InChIKey | XPJOAQHSIPECIJ-ULQDDVLXSA-N |
| XLogP | 1.07 |
| TPSA | 121.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.58 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|