C19H36N6O4S — CID 166930416
(2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide (PubChem CID 166930416) has the molecular formula C19H36N6O4S and a molecular weight of 444.60 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide |
|---|---|
| PubChem CID | 166930416 |
| Molecular Formula | C19H36N6O4S |
| Molecular Weight | 444.60 g/mol |
| Exact Mass | 444.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-N-[(2S)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]-4-methylpentanamide |
| SMILES | CSCC[C@H](NC(C)=O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@H](C=O)CCCN=C(N)N |
| InChI | InChI=1S/C19H36N6O4S/c1-12(2)10-16(25-17(28)15(7-9-30-4)23-13(3)27)18(29)24-14(11-26)6-5-8-22-19(20)21/h11-12,14-16H,5-10H2,1-4H3,(H,23,27)(H,24,29)(H,25,28)(H4,20,21,22)/t14-,15-,16-/m0/s1 |
| InChIKey | APXLRCBHLOLILZ-JYJNAYRXSA-N |
| XLogP | -0.49 |
| TPSA | 168.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.60 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|