C20H39N7O5S2 — CID 18244584
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 18244584) has the molecular formula C20H39N7O5S2 and a molecular weight of 521.71 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 18244584 |
| Molecular Formula | C20H39N7O5S2 |
| Molecular Weight | 521.71 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-4-methylpentanoyl]amino]-3-sulfanylpropanoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCCC(NC(=O)C(CS)NC(=O)C(CC(C)C)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C20H39N7O5S2/c1-11(2)9-14(26-16(28)12(21)5-4-7-24-20(22)23)17(29)27-15(10-33)18(30)25-13(19(31)32)6-8-34-3/h11-15,33H,4-10,21H2,1-3H3,(H,25,30)(H,26,28)(H,27,29)(H,31,32)(H4,22,23,24) |
| InChIKey | MMVCIGNGQCHPOH-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 215.02 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.71 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|