C21H39N7O5S — CID 117094734
(2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]butan-2-yl]pentanamide (PubChem CID 117094734) has the molecular formula C21H39N7O5S and a molecular weight of 501.65 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]butan-2-yl]pentanamide.
| Compound Name | (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]butan-2-yl]pentanamide |
|---|---|
| PubChem CID | 117094734 |
| Molecular Formula | C21H39N7O5S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-5-(diaminomethylideneamino)-N-[(2S)-4-methylsulfanyl-1-oxo-1-[[(2S)-1-oxopropan-2-yl]amino]butan-2-yl]pentanamide |
| SMILES | CSCC[C@H](NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@@H](NC(C)=O)C(C)C)C(=O)N[C@@H](C)C=O |
| InChI | InChI=1S/C21H39N7O5S/c1-12(2)17(26-14(4)30)20(33)28-15(7-6-9-24-21(22)23)19(32)27-16(8-10-34-5)18(31)25-13(3)11-29/h11-13,15-17H,6-10H2,1-5H3,(H,25,31)(H,26,30)(H,27,32)(H,28,33)(H4,22,23,24)/t13-,15-,16-,17-/m0/s1 |
| InChIKey | SDNCVIPMZKQBEA-HJWJTTGWSA-N |
| XLogP | -1.37 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | -1.37 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|