C19H34N2O6S — CID 22296407
dibutyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]butanedioate (PubChem CID 22296407) has the molecular formula C19H34N2O6S and a molecular weight of 418.56 g/mol. Its IUPAC name is dibutyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]butanedioate.
| Compound Name | dibutyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]butanedioate |
|---|---|
| PubChem CID | 22296407 |
| Molecular Formula | C19H34N2O6S |
| Molecular Weight | 418.56 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | dibutyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]butanedioate |
| SMILES | CCCCOC(=O)C[C@H](NC(=O)[C@H](CCSC)NC(C)=O)C(=O)OCCCC |
| InChI | InChI=1S/C19H34N2O6S/c1-5-7-10-26-17(23)13-16(19(25)27-11-8-6-2)21-18(24)15(9-12-28-4)20-14(3)22/h15-16H,5-13H2,1-4H3,(H,20,22)(H,21,24)/t15-,16-/m0/s1 |
| InChIKey | HQDLLSFBEIWLGU-HOTGVXAUSA-N |
| XLogP | 1.81 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|