C17H32N4O5S — CID 59070616
ethyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate (PubChem CID 59070616) has the molecular formula C17H32N4O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate |
|---|---|
| PubChem CID | 59070616 |
| Molecular Formula | C17H32N4O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-acetamido-4-methylsulfanylbutanoyl]amino]-6-[1-(hydroxyamino)ethylideneamino]hexanoate |
| SMILES | CCOC(=O)[C@H](CCCC/N=C(\C)NO)NC(=O)[C@H](CCSC)NC(C)=O |
| InChI | InChI=1S/C17H32N4O5S/c1-5-26-17(24)15(8-6-7-10-18-12(2)21-25)20-16(23)14(9-11-27-4)19-13(3)22/h14-15,25H,5-11H2,1-4H3,(H,18,21)(H,19,22)(H,20,23)/t14-,15-/m0/s1 |
| InChIKey | MVYFWOVSZVTCNY-GJZGRUSLSA-N |
| XLogP | 0.86 |
| TPSA | 129.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|