C16H23F7N2O4S2 — CID 91745226
ethyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate (PubChem CID 91745226) has the molecular formula C16H23F7N2O4S2 and a molecular weight of 504.49 g/mol. Its IUPAC name is ethyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate.
| Compound Name | ethyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91745226 |
| Molecular Formula | C16H23F7N2O4S2 |
| Molecular Weight | 504.49 g/mol |
| Exact Mass | 504.10 |
| IUPAC Name | ethyl 2-[[2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoyl]amino]-4-methylsulfanylbutanoate |
| SMILES | CCOC(=O)C(CCSC)NC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C16H23F7N2O4S2/c1-4-29-12(27)10(6-8-31-3)24-11(26)9(5-7-30-2)25-13(28)14(17,18)15(19,20)16(21,22)23/h9-10H,4-8H2,1-3H3,(H,24,26)(H,25,28) |
| InChIKey | JZYUUBCFPALJSY-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|