C19H30F7NO3S — CID 91740138
decyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate (PubChem CID 91740138) has the molecular formula C19H30F7NO3S and a molecular weight of 485.51 g/mol. Its IUPAC name is decyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate.
| Compound Name | decyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
|---|---|
| PubChem CID | 91740138 |
| Molecular Formula | C19H30F7NO3S |
| Molecular Weight | 485.51 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | decyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylsulfanylbutanoate |
| SMILES | CCCCCCCCCCOC(=O)C(CCSC)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H30F7NO3S/c1-3-4-5-6-7-8-9-10-12-30-15(28)14(11-13-31-2)27-16(29)17(20,21)18(22,23)19(24,25)26/h14H,3-13H2,1-2H3,(H,27,29) |
| InChIKey | HKVIGMQBIBQLFG-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.51 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|