C17H26F7NO3 — CID 91740733
heptyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylpentanoate (PubChem CID 91740733) has the molecular formula C17H26F7NO3 and a molecular weight of 425.39 g/mol. Its IUPAC name is heptyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylpentanoate.
| Compound Name | heptyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 91740733 |
| Molecular Formula | C17H26F7NO3 |
| Molecular Weight | 425.39 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | heptyl 2-(2,2,3,3,4,4,4-heptafluorobutanoylamino)-4-methylpentanoate |
| SMILES | CCCCCCCOC(=O)C(CC(C)C)NC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H26F7NO3/c1-4-5-6-7-8-9-28-13(26)12(10-11(2)3)25-14(27)15(18,19)16(20,21)17(22,23)24/h11-12H,4-10H2,1-3H3,(H,25,27) |
| InChIKey | MZGMHEOMBKWFCT-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|